180859-71-6 Usage
Quinoline ring
A type of heterocyclic compound
Morpholine-4-carbonyl group
Attached to the quinoline ring, suggesting potential bioactive properties
Propanedinitrile group
Enhances reactivity and versatility for chemical modification
Potential applications
Pharmaceutical and medicinal chemistry
Potential candidate for drug development
Due to unique structure and potential pharmacological properties
Interest in drug discovery and development
Because of its unique structure and potential pharmacological properties
Check Digit Verification of cas no
The CAS Registry Mumber 180859-71-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,0,8,5 and 9 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 180859-71:
(8*1)+(7*8)+(6*0)+(5*8)+(4*5)+(3*9)+(2*7)+(1*1)=166
166 % 10 = 6
So 180859-71-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N4O2/c18-10-12(11-19)16-9-14(13-3-1-2-4-15(13)20-16)17(22)21-5-7-23-8-6-21/h1-4,9,12H,5-8H2