180923-81-3 Usage
Description
3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid is a chemical compound with the molecular formula C14H17NO4. It is a derivative of isoindoline and is classified as an organic compound. 3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid is a carboxylic acid with a pentanoic acid group and a 2H-isoindol-2-yl substituent. This unique structure endows it with potential applications in various fields, particularly in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid is used as a key intermediate in the synthesis of new drugs and medications. Its unique chemical structure allows for the development of compounds with specific therapeutic properties, addressing various medical conditions and diseases.
Used in Drug Development:
3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid is utilized as a building block in the design and synthesis of novel pharmaceutical compounds. Its presence in the molecular structure can contribute to the desired pharmacological activity, selectivity, and potency of the final drug product.
Used in Medicinal Chemistry Research:
3-methyl-2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)pentanoic acid serves as a valuable tool in medicinal chemistry research. It can be used to explore the structure-activity relationships of various drug candidates, providing insights into the design of more effective and safer medications.
Check Digit Verification of cas no
The CAS Registry Mumber 180923-81-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,0,9,2 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 180923-81:
(8*1)+(7*8)+(6*0)+(5*9)+(4*2)+(3*3)+(2*8)+(1*1)=143
143 % 10 = 3
So 180923-81-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO3/c1-3-9(2)12(14(17)18)15-8-10-6-4-5-7-11(10)13(15)16/h4-7,9,12H,3,8H2,1-2H3,(H,17,18)
