18109-48-3 Usage
General Description
2',6'-Dimethyl-N-(2-morpholinoethyl)-2-phenylacetanilide is a chemical compound that belongs to the class of acetanilide derivatives. It is a crystalline solid with a molecular formula of C20H27N3O2 and a molecular weight of 353.45 g/mol. 2',6'-Dimethyl-N-(2-morpholinoethyl)-2-phenylacetanilide is utilized in the pharmaceutical industry as an analgesic and antipyretic agent, and it acts by inhibiting the production of prostaglandins, which are involved in the inflammatory response. Additionally, it is also used as a precursor in the synthesis of various pharmaceutical drugs. Due to its pharmacological properties, 2',6'-Dimethyl-N-(2-morpholinoethyl)-2-phenylacetanilide is a valuable chemical in medicinal chemistry research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 18109-48-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,1,0 and 9 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 18109-48:
(7*1)+(6*8)+(5*1)+(4*0)+(3*9)+(2*4)+(1*8)=103
103 % 10 = 3
So 18109-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H28N2O2/c1-18-7-6-8-19(2)22(18)24(12-11-23-13-15-26-16-14-23)21(25)17-20-9-4-3-5-10-20/h3-10H,11-17H2,1-2H3