18127-12-3 Usage
Structure
Bicyclic with two chlorine atoms attached to a methylene group at the bridgehead position
Properties
+ Highly strained
+ Reactive
+ Unique reactivity due to its strained molecular structure
Uses
+ Chemical intermediate in organic synthesis
+ Production of pharmaceuticals and agrochemicals
+ Research and development of new organic compounds
Safety measures
Careful handling and proper safety measures are required due to high reactivity and potential toxicity.
Check Digit Verification of cas no
The CAS Registry Mumber 18127-12-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,1,2 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 18127-12:
(7*1)+(6*8)+(5*1)+(4*2)+(3*7)+(2*1)+(1*2)=93
93 % 10 = 3
So 18127-12-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H12Cl2/c10-9(11)8-5-4-6-2-1-3-7(6)8/h6-7H,1-5H2
