1820-50-4 Usage
General Description
3-(3-cyclohexen-1-yl)-2,4-dioxaspiro[5.5]undec-8-ene is a chemical compound with a complex molecular structure. It is a spirocyclic compound, meaning it contains a bicyclic structure with one ring sharing two atoms with another ring. The presence of the cyclohexenyl group and the dioxaspiro backbone make this compound highly unique and potentially useful in medicinal and synthetic organic chemistry. The spirocyclic structure can provide stereochemical diversity and potential biological activity, making it an interesting target for further research and potential applications in drug development or materials science. However, further studies are necessary to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 1820-50-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,2 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1820-50:
(6*1)+(5*8)+(4*2)+(3*0)+(2*5)+(1*0)=64
64 % 10 = 4
So 1820-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O2/c1-3-7-13(8-4-1)14-16-11-15(12-17-14)9-5-2-6-10-15/h2-3,5,7,13-14H,1,4,6,8-12H2
