182054-69-9 Usage
General Description
3-Pyridinecarbonitrile, 2-(hydroxymethyl)-(9CI) is a chemical compound with the molecular formula C7H6N2O. It is a derivative of pyridine, which is a six-membered heterocyclic ring containing five carbon atoms and one nitrogen atom. The presence of the hydroxymethyl group in this compound makes it a potentially important intermediate in the synthesis of pharmaceuticals and agrochemicals. It also has potential applications in the field of organic synthesis and medicinal chemistry due to its unique chemical structure. Overall, 3-Pyridinecarbonitrile, 2-(hydroxymethyl)-(9CI) is a versatile chemical compound with potential importance in various industrial and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 182054-69-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,2,0,5 and 4 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 182054-69:
(8*1)+(7*8)+(6*2)+(5*0)+(4*5)+(3*4)+(2*6)+(1*9)=129
129 % 10 = 9
So 182054-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N2O/c8-4-6-2-1-3-9-7(6)5-10/h1-3,10H,5H2