18210-26-9 Usage
Uses
Used in Pharmaceutical Industry:
N-(4-[(thiophen-2-ylmethyl)-amino]-phenyl)-acetamide serves as a crucial building block for the synthesis of a range of pharmaceuticals, contributing to the development of new drugs with potential therapeutic applications.
Used as a Research Reagent:
In the realm of drug development, N-(4-[(THIOPHEN-2-YLMETHYL)-AMINO]-PHENYL)-ACETAMIDE acts as a valuable research reagent, facilitating the exploration and understanding of its biological activity and potential medicinal uses.
Used in Medicinal Chemistry:
The presence of the thiophen-2-ylmethylamino group in its structure makes N-(4-[(thiophen-2-ylmethyl)-amino]-phenyl)-acetamide a subject of interest for medicinal chemists, who investigate its properties and interactions to enhance drug discovery processes.
Potential Drug Candidate:
Due to its structural features and potential biological activity, N-(4-[(THIOPHEN-2-YLMETHYL)-AMINO]-PHENYL)-ACETAMIDE may be considered a potential drug candidate, warranting further investigation into its pharmacological properties and efficacy in treating specific conditions or diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 18210-26-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,2,1 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 18210-26:
(7*1)+(6*8)+(5*2)+(4*1)+(3*0)+(2*2)+(1*6)=79
79 % 10 = 9
So 18210-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2OS/c1-10(16)15-12-6-4-11(5-7-12)14-9-13-3-2-8-17-13/h2-8,14H,9H2,1H3,(H,15,16)
