182224-71-1 Usage
Uses
Used in Pharmaceutical Industry:
N4-BENZYL-2,6-DICHLOROISONICOTINAMIDE is used as a building block for the synthesis of various biologically active compounds due to its potential biological and pharmacological activities. It plays a crucial role in the development of new drugs with antibacterial and antitumor properties.
Used in Research Applications:
In the research field, N4-BENZYL-2,6-DICHLOROISONICOTINAMIDE is used as an intermediate in the production of many drugs and dyes. Its unique structure and properties make it a valuable tool for chemical and biological research, aiding in the exploration of new chemical pathways and the discovery of novel therapeutic agents.
Used in Chemical Industry:
N4-BENZYL-2,6-DICHLOROISONICOTINAMIDE is also utilized in the chemical industry as an intermediate for the production of dyes. Its chemical properties contribute to the development of new dyes with specific characteristics, enhancing the range of colorants available for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 182224-71-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,2,2,2 and 4 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 182224-71:
(8*1)+(7*8)+(6*2)+(5*2)+(4*2)+(3*4)+(2*7)+(1*1)=121
121 % 10 = 1
So 182224-71-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H10Cl2N2O/c14-11-6-10(7-12(15)17-11)13(18)16-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,16,18)
