182344-14-5 Usage
Description
(3-FLUORO-4-HYDROXYPHENYL)BORONIC ACID, also known as 3-Fluoro-4-hydroxybenzeneboronic acid, is an organic compound with the molecular formula C6H6BFO3. It is a derivative of hydroxybenzene boronic acids and possesses a fluorine atom at the 3rd position and a hydroxyl group at the 4th position. (3-FLUORO-4-HYDROXYPHENYL)BORONIC ACID is characterized by its ability to form stable covalent bonds with other molecules, making it a versatile building block in organic synthesis and a valuable intermediate in the development of various chemical compounds.
Uses
Used in Suzuki Reaction:
(3-FLUORO-4-HYDROXYPHENYL)BORONIC ACID is used as a key component in the Suzuki reaction, a widely employed cross-coupling reaction in organic chemistry. This reaction involves the formation of carbon-carbon bonds between an aryl or vinyl halide and an organoboron compound, facilitated by a palladium catalyst. The use of 3-Fluoro-4-hydroxybenzeneboronic acid in this reaction allows for the synthesis of a variety of biaryl and vinyl aryl compounds, which are important structural motifs in pharmaceuticals, agrochemicals, and advanced materials.
Used as Intermediates in Organic Synthesis:
(3-FLUORO-4-HYDROXYPHENYL)BORONIC ACID is used as intermediates in the synthesis of various organic compounds, particularly those containing the hydroxybenzene moiety. Its unique structural features, including the presence of a fluorine atom and a boronic acid group, make it a valuable building block for the development of new molecules with potential applications in various industries.
Used as Catalysts in Amidation and Esterification:
(3-FLUORO-4-HYDROXYPHENYL)BORONIC ACID can be an effective catalyst for amidation and esterification reactions of carboxylic acids. These reactions are crucial in the synthesis of amides and esters, which are important functional groups in many biologically active molecules, pharmaceuticals, and agrochemicals. The use of this boronic acid as a catalyst can improve the efficiency and selectivity of these reactions, leading to the development of more sustainable and efficient synthetic routes.
Check Digit Verification of cas no
The CAS Registry Mumber 182344-14-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,2,3,4 and 4 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 182344-14:
(8*1)+(7*8)+(6*2)+(5*3)+(4*4)+(3*4)+(2*1)+(1*4)=125
125 % 10 = 5
So 182344-14-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BFO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9-11H