18244-79-6 Usage
Thiazolium salt
A compound containing a thiazolium ring (a five-membered ring with one sulfur atom and one nitrogen atom).
Naphtho ring
A compound containing a naphtho ring (a fused benzene ring system with two six-membered rings).
Methylindol group
A 2-methylindole moiety, which is a derivative of the indole core structure.
Methylnaphtho group
A 1-methylnaphthalene moiety, which is a derivative of the naphthalene core structure.
p-Toluenesulphonate counterion
A specific anionic counterion (p-toluenesulfonate) associated with the thiazolium salt, which influences the compound's solubility and reactivity.
Structural complexity
The presence of multiple functional groups and fused rings contributes to the compound's complex structure.
Potential applications
The compound may have potential uses in organic synthesis, pharmaceuticals, or materials science, but further research is needed to understand its properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18244-79-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,2,4 and 4 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18244-79:
(7*1)+(6*8)+(5*2)+(4*4)+(3*4)+(2*7)+(1*9)=116
116 % 10 = 6
So 18244-79-6 is a valid CAS Registry Number.
InChI:InChI=1/C36H27N3S2.C7H8O3S/c1-22-34(28-14-8-9-15-29(28)37-22)25(20-32-38(2)35-26-12-6-4-10-23(26)16-18-30(35)40-32)21-33-39(3)36-27-13-7-5-11-24(27)17-19-31(36)41-33;1-6-2-4-7(5-3-6)11(8,9)10/h4-21H,1-3H3;2-5H,1H3,(H,8,9,10)/b32-20+;