182483-97-2 Usage
General Description
2-Hydroxy-6-chloropyridine-4-carboxamide is a chemical compound with the molecular formula C6H5ClN2O2. It is a derivative of pyridine and is classified as an amide. 2-HYDROXY-6-CHLOROPYRIDINE-4-CARBOXAMIDE is used in the synthesis of pharmaceuticals and agrochemicals due to its potential as a building block for biologically active compounds. Its properties and structure make it suitable for use in drug development and medicinal chemistry. Additionally, it has been studied for its potential biological activities, including its antibacterial and antifungal properties, making it a valuable compound for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 182483-97-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,2,4,8 and 3 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 182483-97:
(8*1)+(7*8)+(6*2)+(5*4)+(4*8)+(3*3)+(2*9)+(1*7)=162
162 % 10 = 2
So 182483-97-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN2O2/c7-4-1-3(6(8)11)2-5(10)9-4/h1-2H,(H2,8,11)(H,9,10)