18260-66-7 Usage
Uses
Used in Pharmaceutical Industry:
2,6-Difluoro-5-methylpyrimidin-4-ylamine is used as a synthetic intermediate for the development of new pharmaceutical compounds. Its reactivity allows for the creation of a variety of biologically active molecules, which can be further optimized for therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2,6-Difluoro-5-methylpyrimidin-4-ylamine serves as a precursor in the synthesis of new agrochemicals. Its incorporation into these compounds can lead to the development of more effective pesticides or other agricultural products that enhance crop protection and yield.
Used in Medicinal Chemistry Research:
2,6-Difluoro-5-methylpyrimidin-4-ylamine is utilized as a key building block in medicinal chemistry research. Its unique structure provides a foundation for the exploration of novel drug candidates, potentially leading to the discovery of new treatments for various diseases and conditions.
Used in Organic Chemistry Synthesis:
2,6-DIFLUORO-5-METHYLPYRIMIDIN-4-YLAMINE is also used in organic chemistry as a versatile synthetic building block. Its reactivity with other chemical groups allows for the synthesis of a wide range of organic compounds, expanding the scope of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 18260-66-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,2,6 and 0 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 18260-66:
(7*1)+(6*8)+(5*2)+(4*6)+(3*0)+(2*6)+(1*6)=107
107 % 10 = 7
So 18260-66-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5F2N3/c1-2-3(6)9-5(7)10-4(2)8/h1H3,(H2,8,9,10)
