183065-72-7 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Difluoro-6-bromobenzoic acid is used as a chemical intermediate for the synthesis of various organic compounds, particularly in the development of new drugs. Its unique structure and properties make it a promising candidate for the creation of pharmaceuticals with specific therapeutic targets.
Used in Agricultural Industry:
In the agricultural sector, 2,3-difluoro-6-bromobenzoic acid serves as an intermediate in the synthesis of agrochemicals, contributing to the development of effective pesticides and other crop protection agents. Its potential biological activities, such as antimicrobial properties, can be harnessed to enhance crop health and yield.
Used in Research and Development:
2,3-Difluoro-6-bromobenzoic acid is also utilized in research and development settings for studying its potential biological activities, including anti-inflammatory and antimicrobial effects. This research can lead to the discovery of new applications and uses for 2,3-DIFLUORO-6-BROMOBENZOIC ACID in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 183065-72-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,3,0,6 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 183065-72:
(8*1)+(7*8)+(6*3)+(5*0)+(4*6)+(3*5)+(2*7)+(1*2)=137
137 % 10 = 7
So 183065-72-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrF2O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12)
