183304-68-9 Usage
Uses
1. Used in Chemical Research:
1,2,3-Thiadiazole-5-carboxylic acid, 4-(hydroxymethyl)(9CI) is used as a research compound for studying its chemical properties and potential applications in various fields.
2. Used in Pharmaceutical Industry:
1,2,3-Thiadiazole-5-carboxylic acid, 4-(hydroxymethyl)(9CI) is used as a building block or intermediate in the synthesis of pharmaceutical compounds, due to its unique structure and functional groups.
3. Used in Material Science:
1,2,3-Thiadiazole-5-carboxylic acid, 4-(hydroxymethyl)(9CI) is used as a component in the development of new materials with specific properties, such as conductivity, stability, or reactivity.
4. Used in Agrochemical Industry:
1,2,3-Thiadiazole-5-carboxylic acid, 4-(hydroxymethyl)(9CI) is used as a starting material or intermediate in the synthesis of agrochemicals, such as pesticides or herbicides, due to its potential bioactivity.
5. Used in Dye and Pigment Industry:
1,2,3-Thiadiazole-5-carboxylic acid, 4-(hydroxymethyl)(9CI) is used as a precursor in the production of dyes and pigments, taking advantage of its chemical structure to create colorants with desired properties.
Check Digit Verification of cas no
The CAS Registry Mumber 183304-68-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,3,3,0 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 183304-68:
(8*1)+(7*8)+(6*3)+(5*3)+(4*0)+(3*4)+(2*6)+(1*8)=129
129 % 10 = 9
So 183304-68-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2O3S/c7-1-2-3(4(8)9)10-6-5-2/h7H,1H2,(H,8,9)
