18339-14-5 Usage
Properties
1. Chemical Name: 2-[3-(dimethylamino)propyl]-1,2-benzisothiazol-3(2H)-one
2. Common Name: DMDMH
3. Usage: Preservative in personal care and cosmetic products
4. Effectiveness: Highly effective against bacteria, fungi, and yeast
5. Mechanism: Releases formaldehyde as a preservative
6. Shelf Life Extension: Extends the shelf life of consumer products
Specific Content
DMDMH is used as a preservative in various personal care and cosmetic products to prevent microbial growth and extend their shelf life.
It is particularly effective against bacteria, fungi, and yeast, making it a popular choice for preserving these products.
The mechanism of action involves the release of formaldehyde, which acts as a preservative by inhibiting the growth of microorganisms.
However, due to concerns about potential health risks associated with formaldehyde exposure, regulatory agencies have imposed restrictions on the use of DMDMH in certain products.
This has led manufacturers to explore alternative preservatives to ensure product safety while maintaining efficacy in microbial protection.
Check Digit Verification of cas no
The CAS Registry Mumber 18339-14-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,3,3 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 18339-14:
(7*1)+(6*8)+(5*3)+(4*3)+(3*9)+(2*1)+(1*4)=115
115 % 10 = 5
So 18339-14-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2OS/c1-13(2)8-5-9-14-12(15)10-6-3-4-7-11(10)16-14/h3-4,6-7H,5,8-9H2,1-2H3
