18339-94-1 Usage
Uses
Used in Organic Synthesis:
1,1-DIMETHYLSILA-11-CROWN-4 is used as a ligand for metal ions, facilitating the coordination of metal ions to organic substrates and enhancing the efficiency of various organic reactions.
Used in Phase-Transfer Catalysis:
1,1-DIMETHYLSILA-11-CROWN-4 is used as a phase-transfer catalyst in organic reactions, promoting the transfer of reactants between different phases (e.g., aqueous and organic) and improving the overall reaction rate.
Used in Ion Exchange:
1,1-DIMETHYLSILA-11-CROWN-4 is used as an ion exchange material, selectively binding certain metal ions and facilitating their separation from other components in a mixture.
Used in Extraction Processes:
1,1-DIMETHYLSILA-11-CROWN-4 is used in extraction processes, where its ability to selectively bind metal ions aids in the separation and purification of various compounds.
Used in Analytical Chemistry:
1,1-DIMETHYLSILA-11-CROWN-4 is used as a reagent in analytical chemistry, enabling the selective detection and quantification of specific metal ions in samples.
Used in Environmental Remediation:
1,1-DIMETHYLSILA-11-CROWN-4 is used in environmental remediation applications, where its metal ion binding properties can help in the removal of toxic metal ions from contaminated sites.
Check Digit Verification of cas no
The CAS Registry Mumber 18339-94-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,3,3 and 9 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 18339-94:
(7*1)+(6*8)+(5*3)+(4*3)+(3*9)+(2*9)+(1*4)=131
131 % 10 = 1
So 18339-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H18O4Si/c1-13(2)11-7-5-9-3-4-10-6-8-12-13/h3-8H2,1-2H3
