18355-09-4 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
1-(Acetyloxy)-4,5,6,7-tetrachloro-1H-benzotriazole is used as a reagent in the synthesis of pharmaceuticals and agrochemicals for its strong acylating properties. It serves as a mild acetylating reagent for alcohols, phenols, and amines, and as a chlorinating agent for a wide range of substrates, facilitating the creation of complex organic compounds.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(Acetyloxy)-4,5,6,7-tetrachloro-1H-benzotriazole is utilized as a versatile building block for the synthesis of other complex organic compounds. Its tetrachloro substitution pattern and benzotriazole core structure provide stability and resistance to oxidative degradation, making it an essential component in the development of new compounds for various applications.
Used in Chemical Reactions:
1-(Acetyloxy)-4,5,6,7-tetrachloro-1H-benzotriazole is also used for the protection of sensitive functional groups during chemical reactions. Its stability and resistance to oxidative degradation make it a reliable choice for safeguarding reactive sites in complex molecular structures, ensuring the successful completion of the desired reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 18355-09-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,3,5 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18355-09:
(7*1)+(6*8)+(5*3)+(4*5)+(3*5)+(2*0)+(1*9)=114
114 % 10 = 4
So 18355-09-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H3Cl4N3O2/c1-2(16)17-15-8-6(12)4(10)3(9)5(11)7(8)13-14-15/h1H3
