183586-34-7 Usage
General Description
"1H-Pyrrolo[3,2-c]pyridine, 6-methyl-" is a chemical compound belonging to the class of organic compounds known as pyrrolopyridines. Pyrrolopyridines are compounds containing a pyrrolopyridine moiety, which is a tricyclic compound made up of a pyrrole ring fused to a pyridine ring. "1H-Pyrrolo[3,2-c]pyridine, 6-methyl-" specifically has a methyl group attached to it. Although its specific uses and properties can vary depending on its exact structure and formulation, it is generally involved in various chemical reactions and processes due to its complex structure. As with all chemicals, it must be handled and stored safely considering its potential reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 183586-34-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,3,5,8 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 183586-34:
(8*1)+(7*8)+(6*3)+(5*5)+(4*8)+(3*6)+(2*3)+(1*4)=167
167 % 10 = 7
So 183586-34-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2/c1-6-4-8-7(5-10-6)2-3-9-8/h2-5,9H,1H3
