183586-34-7 Usage
Uses
1H-Pyrrolo[3,2-c]pyridine, 6-methylis used as a chemical intermediate for the synthesis of various compounds in the pharmaceutical industry. Its complex structure and reactivity make it a valuable building block for the development of new drugs and medicinal agents.
Used in Pharmaceutical Industry:
1H-Pyrrolo[3,2-c]pyridine, 6-methylis used as a key component in the synthesis of pharmaceutical compounds for the development of new drugs and medicinal agents. Its unique structure and reactivity contribute to the creation of novel therapeutic agents with potential applications in the treatment of various diseases and conditions.
1H-Pyrrolo[3,2-c]pyridine, 6-methylis also used as a research tool in the field of organic chemistry. Its complex structure and potential reactivity make it an interesting subject for study, allowing researchers to explore new reaction pathways and mechanisms, as well as to develop new synthetic strategies and methodologies.
Used in Research and Development:
1H-Pyrrolo[3,2-c]pyridine, 6-methylis used as a research compound for the investigation of new reaction pathways, mechanisms, and synthetic strategies in the field of organic chemistry. Its unique structure provides opportunities for the discovery of novel chemical processes and the development of innovative methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 183586-34-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,3,5,8 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 183586-34:
(8*1)+(7*8)+(6*3)+(5*5)+(4*8)+(3*6)+(2*3)+(1*4)=167
167 % 10 = 7
So 183586-34-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2/c1-6-4-8-7(5-10-6)2-3-9-8/h2-5,9H,1H3
