18359-88-1 Usage
Thiazolium ring
A five-membered heterocyclic ring with two nitrogen atoms and one sulfur atom.
Highly conjugated molecule
The presence of multiple alternating single and double bonds allows for delocalization of electrons, which can affect the compound's color, stability, and reactivity.
Multiple aromatic rings
The compound contains several benzene rings, which are characterized by their stability and aromaticity due to the delocalization of electrons.
Positively charged iodide ion
The presence of an iodide ion (I-) indicates that the compound has a positive charge, which can affect its reactivity and interactions with other molecules.
Unique substitution pattern
The specific arrangement of substituents on the thiazolium ring can give the compound unique properties that may be of interest in various applications.
Organic synthesis utility
The presence of the thiazolium ring makes this compound useful as a catalyst in various organic reactions, potentially increasing the efficiency and selectivity of these reactions.
Potential pharmaceutical or materials science applications
The unique properties of this compound may make it useful in the development of new drugs or materials with specific characteristics.
Handling precautions
Due to its complex structure and potential reactivity, this compound should be handled with care and caution to avoid hazardous situations.
Check Digit Verification of cas no
The CAS Registry Mumber 18359-88-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,3,5 and 9 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 18359-88:
(7*1)+(6*8)+(5*3)+(4*5)+(3*9)+(2*8)+(1*8)=141
141 % 10 = 1
So 18359-88-1 is a valid CAS Registry Number.
InChI:InChI=1/C29H25N2S2.HI/c1-3-30-26(32-24-18-16-20-10-5-7-12-22(20)28(24)30)14-9-15-27-31(4-2)29-23-13-8-6-11-21(23)17-19-25(29)33-27;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1