1836-73-3 Usage
Description
3-chloro-2-(4-nitrophenoxy)toluene is a chemical compound characterized by the molecular formula C14H10ClNO3. It is a crystalline solid that serves as a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals. As a chlorinated derivative of 4-nitrotoluene, it features a chlorine atom and a 4-nitrophenoxy group attached to the second carbon of the toluene ring, making it a key building block for the preparation of various organic compounds and a valuable research chemical in the realm of organic synthesis.
Uses
Used in Pharmaceutical Industry:
3-chloro-2-(4-nitrophenoxy)toluene is used as a key intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 3-chloro-2-(4-nitrophenoxy)toluene is utilized as an essential intermediate in the production of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals.
Used in Organic Synthesis Research:
3-chloro-2-(4-nitrophenoxy)toluene is employed as a research chemical in the field of organic synthesis. Its reactivity and structural features make it a valuable starting material for the preparation of a wide range of organic compounds, facilitating the discovery and development of novel chemical entities with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1836-73-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,3 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1836-73:
(6*1)+(5*8)+(4*3)+(3*6)+(2*7)+(1*3)=93
93 % 10 = 3
So 1836-73-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H10ClNO3/c1-9-3-2-4-12(14)13(9)18-11-7-5-10(6-8-11)15(16)17/h2-8H,1H3