184031-21-8 Usage
General Description
The chemical "1H-(2)Benzopyrano(4,3-c)pyridin-1-one, 6-ethyl-2,6,6a,7,8,9,10,10a-octahydro-2-hydroxy-6a,8,10-trimethyl-, (6R,6aS,8S,10R,10aS)-rel-( )-" is a complex organic compound with a long chemical name. It has a molecular structure that consists of a benzopyranopyridinone ring system with a side chain attached at the 6th position. The compound has a total of four stereocenters, and the full name indicates the specific stereochemistry of each of these stereocenters. This chemical is likely to have various pharmacological properties and may be used as a drug or as a precursor in the synthesis of other compounds due to its complex structure.
Check Digit Verification of cas no
The CAS Registry Mumber 184031-21-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,4,0,3 and 1 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 184031-21:
(8*1)+(7*8)+(6*4)+(5*0)+(4*3)+(3*1)+(2*2)+(1*1)=108
108 % 10 = 8
So 184031-21-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H25NO3/c1-5-13-17(4)9-10(2)8-11(3)15(17)14-12(21-13)6-7-18(20)16(14)19/h6-7,10-11,13,15,20H,5,8-9H2,1-4H3/t10-,11+,13+,15+,17+/m0/s1