184360-52-9 Usage
Uses
Used in Pharmaceutical Research:
(S)-2-Amino-1-(pyrrolidin-1-yl)propane-1-thione hydrochloride is used as a research compound for exploring its potential biological activity and interactions with biological systems. Its unique structure and properties make it a valuable tool in the discovery and development of new drugs and therapeutic agents.
Used in Drug Development:
In the pharmaceutical industry, (S)-2-Amino-1-(pyrrolidin-1-yl)propane-1-thione hydrochloride is used as a key intermediate or building block in the synthesis of various drug candidates. Its versatility and potential biological activity contribute to the design and optimization of novel therapeutic agents with improved efficacy and selectivity.
Used in Organic Synthesis:
(S)-2-Amino-1-(pyrrolidin-1-yl)propane-1-thione hydrochloride is employed as a reagent in organic synthesis processes. Its unique functional groups and chemical properties enable the formation of diverse chemical entities, which can be further utilized in the development of pharmaceuticals, agrochemicals, or other specialty chemicals.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (S)-2-Amino-1-(pyrrolidin-1-yl)propane-1-thione hydrochloride is used as a versatile scaffold for the design and synthesis of bioactive molecules. Its ability to interact with biological targets, such as enzymes, receptors, or ion channels, makes it a valuable component in the development of new therapeutic agents with potential applications in various disease areas.
Overall, (S)-2-Amino-1-(pyrrolidin-1-yl)propane-1-thione hydrochloride is a multifaceted compound with a wide range of potential applications in the fields of chemistry, pharmaceutical research, drug development, and medicinal chemistry. Its unique structure, potential biological activity, and versatility in synthesis processes make it an invaluable asset in the pursuit of novel therapeutic agents and chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 184360-52-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,4,3,6 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 184360-52:
(8*1)+(7*8)+(6*4)+(5*3)+(4*6)+(3*0)+(2*5)+(1*2)=139
139 % 10 = 9
So 184360-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N2S.ClH/c1-6(8)7(10)9-4-2-3-5-9;/h6H,2-5,8H2,1H3;1H/t6-;/m0./s1
