18438-99-8 Usage
Uses
Used in Organic Synthesis:
8-iodocoumarin is used as a reagent for the formation of carbon-carbon and carbon-heteroatom bonds, facilitating various organic synthesis reactions. Its iodine atom plays a crucial role in these reactions, enhancing the compound's reactivity and selectivity.
Used in Pharmaceutical Research:
8-iodocoumarin is used as a subject of interest in pharmaceutical research due to its potential biological activities, including antifungal, antiviral, and antitumor properties. Its diverse applications in medicinal chemistry make it a valuable compound for the development of new drugs and therapies.
Used in Antifungal Applications:
8-iodocoumarin is used as an antifungal agent, exhibiting activity against various fungal species. Its unique structure allows it to target and inhibit essential fungal processes, making it a potential candidate for the development of new antifungal drugs.
Used in Antiviral Applications:
8-iodocoumarin is used as an antiviral agent, showing potential to inhibit viral replication and infection. Its ability to interfere with viral processes makes it a promising compound for the development of new antiviral therapies.
Used in Antitumor Applications:
8-iodocoumarin is used as an antitumor agent, demonstrating potential to inhibit tumor growth and progression. Its unique structure and biological activities make it a valuable compound for the development of new cancer treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 18438-99-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,4,3 and 8 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18438-99:
(7*1)+(6*8)+(5*4)+(4*3)+(3*8)+(2*9)+(1*9)=138
138 % 10 = 8
So 18438-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H12IN5O5/c11-9-13-3-6(14-10(12)15-7(3)20)16(9)8-5(19)4(18)2(1-17)21-8/h2,4-5,8,17-19H,1H2,(H3,12,14,15,20)
