1844-56-0 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloro-2-(4-chlorophenyl)imidazo[1,2-b]pyridazine is utilized as a potential pharmaceutical agent for the development of new drugs. Its unique structure and properties contribute to its potential medicinal chemistry applications, making it a valuable compound for further research and development in the field.
Used in Organic Synthesis:
As a useful building block in organic synthesis, 6-Chloro-2-(4-chlorophenyl)imidazo[1,2-b]pyridazine plays a crucial role in the creation of various complex organic compounds. Its presence in the synthesis process can lead to the development of novel molecules with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1844-56-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,4 and 4 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1844-56:
(6*1)+(5*8)+(4*4)+(3*4)+(2*5)+(1*6)=90
90 % 10 = 0
So 1844-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H7Cl2N3/c13-9-3-1-8(2-4-9)10-7-17-12(15-10)6-5-11(14)16-17/h1-7H
1844-56-0Relevant academic research and scientific papers
SELECTIVE LIGANDS OF HUMAN CONSTITUTIVE ANDROSTANE RECEPTOR
-
Page/Page column 17-18, (2020/11/12)
The present invention provides a structurally novel class of heterocyclic compounds of general formula I wherein L1 is heteroaryl and L2 is heteroaryl or aryl. The novel compounds are useful in a method of prevention or treatment of a condition which is m
