18448-68-5 Usage
General Description
1-(dodecyloxy)-3-[(2-hydroxyethyl)amino]propan-2-ol is a chemical compound with a long hydrocarbon chain attached to a propan-2-ol backbone. It also contains an amino group and a hydroxyethyl group, both of which contribute to its chemical properties. 1-(dodecyloxy)-3-[(2-hydroxyethyl)amino]propan-2-ol is often used as a surfactant or emulsifier in various industrial and household products, including personal care items, pharmaceuticals, and cleaning agents. Its long hydrocarbon chain allows it to interact with both water and oil, making it useful for creating stable emulsions and reducing surface tension. Additionally, the presence of the amino and hydroxyethyl groups makes it biologically active and capable of interacting with biological systems when used in pharmaceutical formulations or cosmetic products.
Check Digit Verification of cas no
The CAS Registry Mumber 18448-68-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,4,4 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 18448-68:
(7*1)+(6*8)+(5*4)+(4*4)+(3*8)+(2*6)+(1*8)=135
135 % 10 = 5
So 18448-68-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H37NO3/c1-2-3-4-5-6-7-8-9-10-11-14-21-16-17(20)15-18-12-13-19/h17-20H,2-16H2,1H3
