18518-71-3 Usage
Uses
Used in Pharmaceutical Industry:
CHROMAN-3-YLAMINE HYDROCHLORIDE is used as a key intermediate in the synthesis of pharmaceutical drugs for its ability to contribute to the development of biologically active compounds. Its unique structure allows for the creation of new drug candidates with potential therapeutic benefits.
Used in Organic Synthesis:
In the realm of organic synthesis, CHROMAN-3-YLAMINE HYDROCHLORIDE serves as a valuable building block, facilitating the creation of a wide array of chemical entities. Its structural attributes make it instrumental in the synthesis of complex organic molecules.
Used in Agrochemical Development:
CHROMAN-3-YLAMINE HYDROCHLORIDE is utilized as a precursor in the development of agrochemicals, where its chemical properties can be harnessed to produce compounds with pesticidal or herbicidal activity, contributing to agricultural productivity and crop protection.
Used in Biological Research:
CHROMAN-3-YLAMINE HYDROCHLORIDE is also used as a subject of biological research to explore its potential pharmacological properties. This involves studying its interactions with biological systems and evaluating its efficacy and safety for possible therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18518-71-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,5,1 and 8 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 18518-71:
(7*1)+(6*8)+(5*5)+(4*1)+(3*8)+(2*7)+(1*1)=123
123 % 10 = 3
So 18518-71-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO.ClH/c10-8-5-7-3-1-2-4-9(7)11-6-8;/h1-4,8H,5-6,10H2;1H
