1852-21-7 Usage
Uses
Used in Pharmaceutical Industry:
Tetrahydro-5-(2-hydroxyethyl)-1,3-bis(hydroxymethyl)-1,3,5-triazin-2(1H)-one is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drug molecules. Its functional groups facilitate the creation of diverse chemical entities with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, tetrahydro-5-(2-hydroxyethyl)-1,3-bis(hydroxymethyl)-1,3,5-triazin-2(1H)-one is utilized as a precursor in the production of agrochemicals, leveraging its reactivity to form compounds with pesticidal or herbicidal properties, thereby enhancing crop protection strategies.
Used in Organic Chemistry Research:
As a reagent in organic chemistry, tetrahydro-5-(2-hydroxyethyl)-1,3-bis(hydroxymethyl)-1,3,5-triazin-2(1H)-one is employed for its capacity to participate in various chemical reactions, aiding researchers in exploring new synthetic pathways and advancing the field of organic synthesis.
Used in Material Science:
Tetrahydro-5-(2-hydroxyethyl)-1,3-bis(hydroxymethyl)-1,3,5-triazin-2(1H)-one is used as a component in the development of new materials and polymers due to its potential to influence the properties of these materials, such as stability, reactivity, and functionality, thus broadening the scope of material applications.
Used in Heterocyclic Compound Synthesis:
tetrahydro-5-(2-hydroxyethyl)-1,3-bis(hydroxymethyl)-1,3,5-triazin-2(1H)-one serves as a fundamental building block in the synthesis of heterocyclic compounds, which are essential in various chemical and pharmaceutical applications. Its unique structure allows for the formation of complex heterocyclic systems with diverse properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 1852-21-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,5 and 2 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1852-21:
(6*1)+(5*8)+(4*5)+(3*2)+(2*2)+(1*1)=77
77 % 10 = 7
So 1852-21-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H15N3O4/c11-2-1-8-3-9(5-12)7(14)10(4-8)6-13/h11-13H,1-6H2
