18529-69-6 Usage
Description
4-Hydroxy-2-methylpyrimidine-5-carboxylic acid is a pyrimidine derivative with the molecular formula C6H6N2O4. It is a heterocyclic organic compound characterized by a ring structure composed of carbon and nitrogen atoms. 4-HYDROXY-2-METHYLPYRIMIDINE-5-CARBOXYLIC ACID features a hydroxyl group (OH), a carboxylic acid group (COOH), and a methyl group (CH3) at the 2-position. It is utilized in the synthesis of pharmaceuticals and agrochemicals and exhibits potential biological activity as an enzyme inhibitor. Furthermore, it is employed in research and development within the realm of organic chemistry.
Uses
Used in Pharmaceutical Synthesis:
4-Hydroxy-2-methylpyrimidine-5-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Synthesis:
4-HYDROXY-2-METHYLPYRIMIDINE-5-CARBOXYLIC ACID is also utilized in the production of agrochemicals, contributing to the development of effective pesticides and other agricultural products.
Used in Enzyme Inhibition Research:
4-Hydroxy-2-methylpyrimidine-5-carboxylic acid is used as an inhibitor of certain enzymes, making it a valuable tool in biological research. Its ability to inhibit specific enzymes can provide insights into enzyme function and potential therapeutic applications.
Used in Organic Chemistry Research and Development:
In the field of organic chemistry, 4-Hydroxy-2-methylpyrimidine-5-carboxylic acid is employed in research and development to explore new chemical reactions and syntheses, further expanding the understanding of organic compounds and their applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18529-69-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,5,2 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18529-69:
(7*1)+(6*8)+(5*5)+(4*2)+(3*9)+(2*6)+(1*9)=136
136 % 10 = 6
So 18529-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3/c1-3-7-2-4(6(10)11)5(9)8-3/h2H,1H3,(H,10,11)(H,7,8,9)
18529-69-6Relevant articles and documents
Fungicidal heterocyclic aromatic amides and their compositions, methods of use and preparation
-
, (2008/06/13)
A compound having the following formula: wherein R3and M are defined herein, and processes therewith.