1854-39-3 Usage
Uses
Used in Pharmaceutical Industry:
(5-amino-3,9-dimethyl-2,4,8-triazabicyclo[4.3.0]nona-2,4,10-trien-8-yl)-phenyl-methanone is used as a pharmaceutical intermediate for the synthesis of various medicinal compounds due to its unique structural features and functional groups.
Used in Organic Synthesis:
In the field of organic synthesis, (5-amino-3,9-dimethyl-2,4,8-triazabicyclo[4.3.0]nona-2,4,10-trien-8-yl)-phenyl-methanone serves as a key building block for the creation of more complex organic molecules, potentially leading to the development of new drugs and other chemical products.
Used in Materials Science:
(5-amino-3,9-dimethyl-2,4,8-triazabicyclo[4.3.0]nona-2,4,10-trien-8-yl)-phenyl-methanone may also find applications in materials science, where its unique structure and properties could be utilized in the development of new materials with specific characteristics, such as improved stability or reactivity.
Further analysis and testing would be required to fully understand the chemical's potential and unlock its full range of applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1854-39-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,5 and 4 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1854-39:
(6*1)+(5*8)+(4*5)+(3*4)+(2*3)+(1*9)=93
93 % 10 = 3
So 1854-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N4O/c1-9-13-12(14(16)18-10(2)17-13)8-19(9)15(20)11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3,(H2,16,17,18)
