185422-96-2 Usage
Uses
Used in Pharmaceutical Industry:
2,6-DICHLORO-3-HYDROXYPYRIDINE-4-CARBOXYLIC ACID is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents due to its unique chemical structure and reactivity.
Used in Agrochemical Industry:
2,6-DICHLORO-3-HYDROXYPYRIDINE-4-CARBOXYLIC ACID is used as a key component in the production of fungicides and herbicides, leveraging its chemical properties to control or prevent the growth of unwanted plants and fungi, thereby enhancing crop protection and yield.
These applications highlight the versatility and importance of 2,6-DICHLORO-3-HYDROXYPYRIDINE-4-CARBOXYLIC ACID in both the pharmaceutical and agrochemical sectors, where it plays a crucial role in the creation of effective and innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 185422-96-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,5,4,2 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 185422-96:
(8*1)+(7*8)+(6*5)+(5*4)+(4*2)+(3*2)+(2*9)+(1*6)=152
152 % 10 = 2
So 185422-96-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl2NO3/c7-3-1-2(6(11)12)4(10)5(8)9-3/h1,10H,(H,11,12)
