18549-65-0 Usage
Description
7-DEAZAPURINE, also known as 7-deazaadenine, is an organic compound with the CAS number 18549-65-0. It is an orange powder and is primarily used in organic synthesis due to its unique chemical properties.
Uses
Used in Organic Synthesis:
7-DEAZAPURINE is used as a synthetic building block for the development of various organic compounds. Its unique structure allows it to be a versatile component in the synthesis of complex molecules, particularly in the pharmaceutical and chemical industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 7-DEAZAPURINE is used as a key intermediate in the synthesis of various drugs, including those with potential therapeutic applications. Its unique chemical properties make it a valuable asset in the development of new medications and drug candidates.
Used in Chemical Research:
7-DEAZAPURINE is also utilized in chemical research as a model compound to study the properties and reactivity of related molecules. This helps researchers gain a better understanding of the underlying chemical mechanisms and can lead to the discovery of new synthetic routes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18549-65-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,5,4 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 18549-65:
(7*1)+(6*8)+(5*5)+(4*4)+(3*9)+(2*6)+(1*5)=140
140 % 10 = 0
So 18549-65-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H18O3Si/c24-20(23-18-14-8-3-9-15-18)19(21-16-10-4-1-5-11-16)22-17-12-6-2-7-13-17/h1-15H,24H3