185515-12-2 Usage
General Description
5,6-Dihydro-4H-cyclopenta(b)thiophene-5-carboxylic acid is a chemical compound with a molecular formula C9H10O2S. It is a derivative of cyclopentathiophene and contains a carboxylic acid functional group. 5,6-DIHYDRO-4H-CYCLOPENTA(B)THIOPHENE-5-CARBOXYLIC ACID is primarily used in the synthesis of pharmaceuticals and agrochemicals. It is also used as an intermediate in the production of various organic compounds. Additionally, it has been studied for its potential biological and pharmacological properties. Overall, 5,6-Dihydro-4H-cyclopenta(b)thiophene-5-carboxylic acid is a versatile chemical with various applications in the fields of chemistry and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 185515-12-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,5,5,1 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 185515-12:
(8*1)+(7*8)+(6*5)+(5*5)+(4*1)+(3*5)+(2*1)+(1*2)=142
142 % 10 = 2
So 185515-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O2S/c9-8(10)6-3-5-1-2-11-7(5)4-6/h1-2,6H,3-4H2,(H,9,10)
