18583-59-0

Usage

Uses

Used in Inorganic Chemistry:
POTASSIUM DIHYDROBIS(1-PYRAZOLYL)BORATE is used as a stabilizing agent for the synthesis of metal complexes, enhancing their stability and reactivity in various chemical reactions.
Used in Catalysis:
In the field of catalysis, POTASSIUM DIHYDROBIS(1-PYRAZOLYL)BORATE is utilized as a ligand to improve the efficiency and selectivity of catalytic processes, contributing to the development of more sustainable and efficient chemical transformations.
Used in Homogeneous Catalysis:
POTASSIUM DIHYDROBIS(1-PYRAZOLYL)BORATE is employed as a ligand in homogeneous catalysis, where it plays a crucial role in stabilizing metal catalysts and facilitating their homogeneous distribution in reaction mixtures, leading to improved catalytic performance.
Used in Polymer Chemistry:
In polymer chemistry, POTASSIUM DIHYDROBIS(1-PYRAZOLYL)BORATE is used as a ligand to stabilize metal catalysts involved in polymerization reactions, enabling the synthesis of polymers with controlled structures and properties.
Overall, POTASSIUM DIHYDROBIS(1-PYRAZOLYL)BORATE is a versatile and important compound in various chemical fields, playing a crucial role in the development of new catalysts and chemical processes.

InChI:InChI=1/C6H8BN4.K/c1-3-8-10(5-1)7-11-6-2-4-9-11;/h1-6H,7H2;/q-1;+1

Upstream product

• 288-13-1 NH-pyrazole 

Relevant academic research and scientific papers

Synthesis, structural characterization, and properties of heavier alkaline earth complexes containing bis(pyrazolyl)borate or bis(3,5-diisopropylpyrazolyl) borate ligands

Treatment of a solid mixture of KBH4 with six equivalents of 3,5-diisopropylpyrazole (iPr2pzH) at 180 °C afforded KTp iPr2(iPr2PzH)3 in 53% yield. KBpiPr2 was synthesized in 56% yield by treatment of a 1:2 M ratio of KBH4 and iPr2PzH in refluxing dimethylacetamide. Treatment of MI2 (M = Ca, Sr, Ba) with two equivalents of KBp or KBpiPr2 in tetrahydrofuran afforded MBp2(THF)2 (M = Ca, 64%, M = Sr, 81%), BaBp 2(THF)4 (32%), and M(BpiPr2) 2(THF)2 (M = Ca, 63%; M = Sr, 61%, M = Ba, 48%) as colorless crystalline solids upon workup. These complexes were characterized by spectral and analytical techniques and by X-ray crystal structure determinations of all complexes except KBpiPr2. KTpi Pr2(iPr2PzH)3 contains one κ3- N,N,N-TpiPr2 ligand and three κ1-iPr 2pzH ligands, with overall distorted octahedral geometry about the K ion. The iPr2PzH nitrogen-hydrogen bonds are engaged in intramolecular hydrogen bonding to the 2-nitrogen atoms of the Tp iPr2 ligand. The solid state structures of MBp 2(THF)2, BaBp2(THF)4, and M(Bp iPr2)2(THF)2 contain κ3-N,N,H Bp and BpiPr2 ligands, which form through metal-nitrogen bond formation to the 2-nitrogen atoms of the pyrazolyl fragments and metal-hydrogen bond formation to one boron-bound hydrogen atom per Bp ligand. SrBp2(THF)2has the shortest metal-hydrogen interactions among the series. A combination of preparative sublimations, solid state decomposition temperatures, and thermogravimetric analysis demonstrated that MBp2(THF)2, BaBp 2(THF)4, and M(BpiPr2) 2(THF)2 undergo solid state decomposition at moderate temperatures.