1859-22-9 Usage
Chemical classification
Spiro compound
Explanation
Different sources of media describe the Explanation of 1859-22-9 differently. You can refer to the following data:
1. Contains two spiro atoms, which are connected in a spiro manner.
2. The compound has a tricyclic framework with a spirocyclic core.
3. Contains multiple oxygen atoms in a cyclic structure.
4. Due to its unique structure, it may be useful in pharmaceuticals, materials science, and organic chemistry.
5. Further study is needed to fully understand the capabilities and limitations of this compound.
6. Represents the composition of the compound, with 9 carbon, 14 hydrogen, and 3 oxygen atoms.
7. The presence of these atoms contributes to the compound's unique properties and potential applications.
8. The compound's structure is intricate, which may make it challenging to synthesize and study.
9. Given its unique properties and potential applications, more research is needed to explore its full potential.
Molecular structure
Unique and complex
Type of compound
Cyclic ether
Potential applications
Various fields
Research and exploration
Warranted
Structural features
Multiple oxygen atoms and spiro atoms
Complexity
High
Potential for further study
High
Check Digit Verification of cas no
The CAS Registry Mumber 1859-22-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,5 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1859-22:
(6*1)+(5*8)+(4*5)+(3*9)+(2*2)+(1*2)=99
99 % 10 = 9
So 1859-22-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H14O3/c1-3-9(11-7-1)5-6-10(13-9)4-2-8-12-10/h5-6H,1-4,7-8H2/t9-,10u/m1/s1
