185949-59-1 Usage
Explanation
Different sources of media describe the Explanation of 185949-59-1 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 10 carbon (C) atoms, 13 hydrogen (H) atoms, and 3 nitrogen (N) atoms.
2. This describes the specific arrangement of atoms and bonds in the molecule. The compound is a derivative of benzimidazole and methanamine, with two methyl groups (CH3) attached to the nitrogen atoms.
3. The compound is derived from benzimidazole, which is a heterocyclic aromatic organic compound consisting of a benzene fused to an imidazole ring.
4. The compound is also derived from methanamine, which is an organic compound containing an amine functional group (-NH2) attached to a single carbon atom.
5. The compound has potential applications in medicinal chemistry, particularly in the development of pharmaceutical drugs. Its unique structure and properties make it an interesting candidate for further research and exploration in drug discovery and development.
6. The specific properties and potential uses of this compound would depend on further studies and testing to determine its effectiveness, safety, and other relevant factors in the context of pharmaceutical drug development.
Chemical Structure
1H-Benzimidazole-2-methanamine, alpha,5-dimethyl
Derivative of Benzimidazole
Yes
Derivative of Methanamine
Yes
Methyl Groups
Two
Potential Applications
Medicinal Chemistry
Further Studies and Testing
Required
Check Digit Verification of cas no
The CAS Registry Mumber 185949-59-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,5,9,4 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 185949-59:
(8*1)+(7*8)+(6*5)+(5*9)+(4*4)+(3*9)+(2*5)+(1*9)=201
201 % 10 = 1
So 185949-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3/c1-6-3-4-8-9(5-6)13-10(12-8)7(2)11/h3-5,7H,11H2,1-2H3,(H,12,13)
185949-59-1Relevant articles and documents
Synthesis and evaluation of selected benzimidazole derivatives as potential antimicrobial agents
Alasmary, Fatmah A.S.,Snelling, Anna M.,Zain, Mohammed E.,Alafeefy, Ahmed M.,Awaad, Amani S.,Karodia, Nazira
supporting information, p. 15206 - 15223 (2015/09/21)
A library of 53 benzimidazole derivatives, with substituents at positions 1, 2 and 5, were synthesized and screened against a series of reference strains of bacteria and fungi of medical relevance. The SAR analyses of the most promising results showed that the antimicrobial activity of the compounds depended on the substituents attached to the bicyclic heterocycle. In particular, some compounds displayed antibacterial activity against two methicillin-resistant Staphylococcus aureus (MRSA) strains with minimum inhibitory concentrations (MICs) comparable to the widely-used drug ciprofloxacin. The compounds have some common features; three possess 5-halo substituents; two are derivatives of (S)-2-ethanaminebenzimidazole; and the others are derivatives of one 2-(chloromethyl)-1Hbenzo[ d]imidazole and (1H-benzo[d]imidazol-2-yl)methanethiol. The results from the antifungal screening were also very interesting: 23 compounds exhibited potent fungicidal activity against the selected fungal strains. They displayed equivalent or greater potency in their MIC values than amphotericin B. The 5-halobenzimidazole derivatives could be considered promising broad-spectrum antimicrobial candidates that deserve further study for potential therapeutic applications.