1862-17-5 Usage
Uses
Used in Organic Synthesis:
1-benzhydrylazetidin-3-Ol is used as a chiral auxiliary in the field of organic synthesis for its ability to control the stereochemistry of asymmetric synthesis reactions. This application is crucial for the production of enantiomerically pure compounds, which are essential in various pharmaceutical and chemical industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 1-benzhydrylazetidin-3-Ol is studied for its potential pharmacological properties. It is being investigated for its anti-inflammatory effects, which could be beneficial in the treatment of various inflammatory conditions. Additionally, its anti-cancer effects are of interest, as it may contribute to the development of new therapeutic agents for cancer treatment.
Used in Chemical Research:
1-benzhydrylazetidin-3-Ol is also utilized in chemical research to explore its potential applications in the synthesis of other complex organic molecules. Its unique structure and properties make it a valuable tool for the development of new chemical compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 1862-17-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,6 and 2 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1862-17:
(6*1)+(5*8)+(4*6)+(3*2)+(2*1)+(1*7)=85
85 % 10 = 5
So 1862-17-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO/c18-15-11-17(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16,18H,11-12H2
1862-17-5Relevant academic research and scientific papers
CARBAMOYL-TYPE BENZOFURAN DERIVATIVES
-
Page/Page column 64, (2008/06/13)
The present invention provides a carbamoyl-type benzofuran derivative of the formula [1]: wherein Ring Z is a group of the formula: etc.; A is a single bond, and the like; Y is a cycloalkanediyl group, etc.; R4 and R5 are the same or different and each is an optionally substituted lower alkyl group, etc.; R1 is a halogen atom, etc.; Ring B of the formula: is an optionally substituted benzene ring; and R3 is a hydrogen atom, etc., or a pharmaceutically acceptable salt thereof, which is useful as an FXa inhibitor.
Xi:Irritant;
