18625-22-4 Usage
General Description
D-Leucyl-Glycyl-Glycine (LLG) is a tripeptide composed of the amino acids leucine, glycine, and glycine, linked together by peptide bonds. It is commonly used in research and pharmaceuticals due to its potential biological activities, including antioxidant, anti-inflammatory, and anti-hypertensive properties. LLG has been studied for its potential role in neurological disorders, cardiovascular health, and skin rejuvenation. It may also have potential applications in drug delivery systems and as a precursor for the synthesis of other bioactive compounds. Overall, D-Leucyl-Glycyl-Glycine holds promise for various therapeutic and industrial applications due to its unique chemical structure and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 18625-22-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,6,2 and 5 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 18625-22:
(7*1)+(6*8)+(5*6)+(4*2)+(3*5)+(2*2)+(1*2)=114
114 % 10 = 4
So 18625-22-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H19N3O4/c1-6(2)3-7(11)10(17)13-4-8(14)12-5-9(15)16/h6-7H,3-5,11H2,1-2H3,(H,12,14)(H,13,17)(H,15,16)/t7-/m1/s1
