18729-20-9 Usage
Uses
Used in Pharmaceutical Industry:
Methyl Tetrahydropyran-3-carboxylate is used as a protecting group for alcohols in organic synthesis, which is crucial for the manufacturing of pharmaceutical drugs. Its ability to protect alcohol groups during chemical reactions allows for the selective modification of other functional groups, facilitating the synthesis of complex drug molecules.
Used in Agrochemical Industry:
METHYL TETRAHYDROPYRAN-3-CARBOXYLATE is also utilized in the synthesis of agrochemicals, contributing to the development of various agricultural products such as pesticides and herbicides. Its role in the synthesis process helps in creating effective and targeted agrochemicals for crop protection and management.
Used in Flavoring Industry:
Methyl Tetrahydropyran-3-carboxylate is employed in the production of flavorings, where its fruity aroma is incorporated into food and beverage products to enhance their taste and appeal. Its use in flavor creation allows for the development of a wide range of flavors, adding variety to the market.
Used in Organic Compound Synthesis:
Beyond its applications in specific industries, Methyl Tetrahydropyran-3-carboxylate is a versatile building block in the synthesis of other organic compounds. Its presence in various chemical reactions enables the creation of a diverse array of molecules with potential applications in research, industry, and consumer products.
Check Digit Verification of cas no
The CAS Registry Mumber 18729-20-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,7,2 and 9 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 18729-20:
(7*1)+(6*8)+(5*7)+(4*2)+(3*9)+(2*2)+(1*0)=129
129 % 10 = 9
So 18729-20-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H12O3/c1-9-7(8)6-3-2-4-10-5-6/h6H,2-5H2,1H3
