1873-52-5 Usage
Uses
Used in Pharmaceutical Industry:
3-Ethylquinoline-4-carboxylic acid is used as a chemical intermediate for the synthesis of pharmaceutical compounds due to its diverse biological activities and potential role in drug development.
Used in Drug Development:
3-Ethylquinoline-4-carboxylic acid is used as a lead compound in drug development for its anticancer properties, as it has been studied for its potential to target and inhibit the growth of cancer cells.
Used in Antimicrobial Applications:
3-Ethylquinoline-4-carboxylic acid is used as an antimicrobial agent for its potential to combat various microorganisms, including bacteria and fungi, due to its ability to disrupt their cellular processes.
Used in Anti-Inflammatory Applications:
3-Ethylquinoline-4-carboxylic acid is used as an anti-inflammatory agent for its potential to reduce inflammation and alleviate symptoms associated with inflammatory conditions.
Further research is needed to fully understand the potential applications and properties of 3-ethylquinoline-4-carboxylic acid, as its diverse biological activities and potential role in the synthesis of pharmaceutical compounds make it a promising candidate for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1873-52-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,7 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1873-52:
(6*1)+(5*8)+(4*7)+(3*3)+(2*5)+(1*2)=95
95 % 10 = 5
So 1873-52-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO2/c1-2-8-7-13-10-6-4-3-5-9(10)11(8)12(14)15/h3-7H,2H2,1H3,(H,14,15)
