1873-52-5 Usage
General Description
3-Ethylquinoline-4-carboxylic acid is a chemical compound that belongs to the class of quinoline derivatives. It is a carboxylic acid derivative with a molecular formula of C13H11NO2. 3-ethylquinoline-4-carboxylic acid is a derivative of quinoline, a nitrogen-containing heterocyclic compound with potential biological and pharmacological activities. 3-Ethylquinoline-4-carboxylic acid has been studied for its potential use in drug development due to its diverse biological activities, including anticancer, antimicrobial, and anti-inflammatory properties. It has also been investigated for its potential role as an organic building block in the synthesis of various pharmaceutical compounds. Further research is needed to fully understand the potential applications and properties of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 1873-52-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,7 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1873-52:
(6*1)+(5*8)+(4*7)+(3*3)+(2*5)+(1*2)=95
95 % 10 = 5
So 1873-52-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO2/c1-2-8-7-13-10-6-4-3-5-9(10)11(8)12(14)15/h3-7H,2H2,1H3,(H,14,15)
