18740-34-6 Usage
Uses
Used in Pharmaceutical Industry:
(4-OXOTHIENO[2,3-D]PYRIMIDIN-3(4H)-YL)ACETIC ACID is used as a pharmaceutical compound for its potential to modulate biological pathways and interact with specific molecular targets. This makes it a valuable compound for research and development in drug design and discovery.
Used in Chemical Processes:
(4-OXOTHIENO[2,3-D]PYRIMIDIN-3(4H)-YL)ACETIC ACID may also have potential uses in various industrial and chemical processes due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 18740-34-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,7,4 and 0 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 18740-34:
(7*1)+(6*8)+(5*7)+(4*4)+(3*0)+(2*3)+(1*4)=116
116 % 10 = 6
So 18740-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O3S/c11-6(12)3-10-4-9-7-5(8(10)13)1-2-14-7/h1-2,4H,3H2,(H,11,12)/p-1
