187663-88-3 Usage
General Description
4-[2-N,N-Diisopropylamino-ethoxy]phenylbromide is a chemical compound with the molecular formula C17H26BrNO. It is a bromide derivative of phenyl, containing a diisopropylamino-ethoxy moiety. 4-[2-N,N-DIISOPROPYLAMINO-ETHOXY]PHENYLBROMIDE has potential applications in medicinal chemistry as an intermediate or building block for the synthesis of pharmaceuticals and bioactive molecules. It can also be used as a reactant in organic synthesis for creating other functionalized compounds. The presence of the diisopropylamino-ethoxy group provides this chemical with unique reactivity and properties that make it valuable in the field of chemical research and drug development. Additionally, it may also have potential uses in other industries such as materials science or agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 187663-88-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,7,6,6 and 3 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 187663-88:
(8*1)+(7*8)+(6*7)+(5*6)+(4*6)+(3*3)+(2*8)+(1*8)=193
193 % 10 = 3
So 187663-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H22BrNO/c1-11(2)16(12(3)4)9-10-17-14-7-5-13(15)6-8-14/h5-8,11-12H,9-10H2,1-4H3