187732-95-2 Usage
Uses
Used in Pharmaceutical Research and Development:
Furo[2,3-b]pyrazine-6-carboxylic acid, 7-amino-, ethyl ester (9CI) is employed as a crucial component in the synthesis of new pharmaceuticals. Its unique structure allows it to be a versatile building block in the design of innovative drug candidates, contributing to the development of novel therapeutic agents.
Used in Medicinal Chemistry Research:
Furo[2,3-b]pyrazine-6-carboxylic acid, 7-amino-, ethyl ester (9CI) is used as a valuable tool in medicinal chemistry research, where its unique properties and structure are explored for potential applications in drug discovery. Its furo[2,3-b]pyrazine backbone and ethyl ester functionality provide a foundation for further chemical modifications and investigations into its biological activity.
Used in Organic Chemistry Research:
Furo[2,3-b]pyrazine-6-carboxylic acid, 7-amino-, ethyl ester (9CI) is also utilized in organic chemistry research, where its reactivity and structural features are studied. This research can lead to a better understanding of the compound's properties and potential applications in various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 187732-95-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,7,7,3 and 2 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 187732-95:
(8*1)+(7*8)+(6*7)+(5*7)+(4*3)+(3*2)+(2*9)+(1*5)=182
182 % 10 = 2
So 187732-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O3/c1-2-14-9(13)7-5(10)6-8(15-7)12-4-3-11-6/h3-4H,2,10H2,1H3
