187970-01-0 Usage
Uses
Used in Pharmaceutical Industry:
(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methanol is used as an antituberculosis agent due to its ability to target and inhibit the growth of Mycobacterium tuberculosis, the causative agent of tuberculosis. Its unique structure allows it to penetrate bacterial cell walls and disrupt essential cellular processes, leading to the death of the bacteria.
(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methanol is also used as an antiviral agent for its potential to inhibit the replication of various viruses. Its molecular structure allows it to interfere with viral enzymes and proteins, preventing the virus from infecting host cells and spreading within the body.
Used in Agricultural Industry:
(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methanol is used as an insecticide for its demonstrated insecticidal activity. Its unique structure enables it to target and disrupt essential physiological processes in insects, leading to their death. (3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methanol has the potential to be developed into a novel and effective insecticide for controlling pests in agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 187970-01-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,7,9,7 and 0 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 187970-01:
(8*1)+(7*8)+(6*7)+(5*9)+(4*7)+(3*0)+(2*0)+(1*1)=180
180 % 10 = 0
So 187970-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O2/c12-5-7-10-8(11-13-7)6-3-1-2-4-9-6/h1-4,12H,5H2
