187973-44-0 Usage
General Description
2-Amino-3-BenzylOxy-5-BromoPyrazine is a chemical compound typically known for its use in many pharmaceutical and medicinal applications due to its chemical properties. It is a derivative of Pyrazine, which is a heterocyclic aromatic organic compound. The presence of an additional benzyl group, an amino (NH2) group, and a bromine atom in the molecular structure enhances the desired chemical or biological functions. Although its potential hazards and handling precautions haven't been widely studied, as a laboratory chemical, adequate protection and care are needed during handling. Depending on their structure, pyrazine derivatives can be utilized as chemical intermediates or building blocks in the synthesis of pharmacologically active molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 187973-44-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,7,9,7 and 3 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 187973-44:
(8*1)+(7*8)+(6*7)+(5*9)+(4*7)+(3*3)+(2*4)+(1*4)=200
200 % 10 = 0
So 187973-44-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrN3O/c12-9-6-14-10(13)11(15-9)16-7-8-4-2-1-3-5-8/h1-6H,7H2,(H2,13,14)