18824-11-8 Usage
General Description
2,2-Dibutyl-1,3,8,11-tetraoxa-2-stannacyclopentadeca-5,13-diene-4,7,12,15-tetrone is a chemical compound with a complicated and long name. It is primarily used as a reagent in organic synthesis and can also function as a cross-linking agent in polymer chemistry. 2,2-Dibutyl-1,3,8,11-tetraoxa-2-stannacyclopentadeca-5,13-diene-4,7,12,15-tetrone contains both butyl and tetraoxa groups, which can contribute to its potential application as a stabilizer or plasticizer. Additionally, the presence of the stannacyclopentadeca-5,13-diene-4,7,12,15-tetrone group suggests the compound may have potential biological activity, though further research is needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 18824-11-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,8,2 and 4 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 18824-11:
(7*1)+(6*8)+(5*8)+(4*2)+(3*4)+(2*1)+(1*1)=118
118 % 10 = 8
So 18824-11-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O8.2C4H9.Sn/c11-7(12)1-3-9(15)17-5-6-18-10(16)4-2-8(13)14;2*1-3-4-2;/h1-4H,5-6H2,(H,11,12)(H,13,14);2*1,3-4H2,2H3;/b3-1-,4-2+;;;/rC10H10O8.C8H18Sn/c11-7(12)1-3-9(15)17-5-6-18-10(16)4-2-8(13)14;1-3-5-7-9-8-6-4-2/h1-4H,5-6H2,(H,11,12)(H,13,14);3-8H2,1-2H3/b3-1-,4-2+;
