188690-84-8 Usage
Uses
Used in Pharmaceutical Industry:
(2S)-HYDROXY(PHENYL)ACETIC ACID (2R)-N-BENZYL-1-(4-METHOXYPHENYL)PROPAN-2-AMINE (1:1) (SALT) is used as an active pharmaceutical ingredient for the development of new drugs. Its unique structure and properties may contribute to the treatment of various diseases by modulating biological pathways or interacting with specific targets in the body.
Used in Research Applications:
In the field of scientific research, this salt serves as a valuable compound for studying its chemical properties, reactivity, and potential interactions with other molecules. It can be utilized in various assays and experiments to gain insights into its behavior and possible applications.
Used in Chemical Processes:
(2S)-HYDROXY(PHENYL)ACETIC ACID (2R)-N-BENZYL-1-(4-METHOXYPHENYL)PROPAN-2-AMINE (1:1) (SALT) can be employed as an intermediate or catalyst in various chemical reactions, taking advantage of its specific functional groups and reactivity. This can lead to the synthesis of new compounds or the improvement of existing chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 188690-84-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,8,6,9 and 0 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 188690-84:
(8*1)+(7*8)+(6*8)+(5*6)+(4*9)+(3*0)+(2*8)+(1*4)=198
198 % 10 = 8
So 188690-84-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H21NO.C8H8O3/c1-14(18-13-16-6-4-3-5-7-16)12-15-8-10-17(19-2)11-9-15;9-7(8(10)11)6-4-2-1-3-5-6/h3-11,14,18H,12-13H2,1-2H3;1-5,7,9H,(H,10,11)/t14-;7-/m10/s1
