188723-58-2 Usage
Uses
Used in Organic Synthesis:
5-Chloro-2-fluorobenzyl alcohol is used as a building block in organic synthesis for its ability to contribute to the formation of various fluorinated and chlorinated organic compounds. Its unique structure allows it to be a key component in the creation of complex organic molecules.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 5-Chloro-2-fluorobenzyl alcohol is used as an intermediate in the development of new drugs. Its presence in the molecular structure can influence the pharmacological properties of the final drug product, potentially enhancing efficacy or modifying the drug's behavior within the body.
Used in Agrochemical Production:
Similarly, in the agrochemical sector, 5-Chloro-2-fluorobenzyl alcohol is utilized as an intermediate in the synthesis of agricultural chemicals. Its role in these products can contribute to the effectiveness of pesticides, herbicides, and other agrochemicals by affecting their stability, solubility, or target specificity.
Used in Medicinal Chemistry Research:
5-Chloro-2-fluorobenzyl alcohol is also used as a research tool in medicinal chemistry. Scientists use 5-Chloro-2-fluorobenzyl alcohol to explore the effects of structural modifications on the biological activity of molecules, which can lead to the discovery of new therapeutic agents.
Used in Material Science:
In the field of material science, 5-Chloro-2-fluorobenzyl alcohol may be employed in the development of new materials with specific properties. The incorporation of chlorine and fluorine atoms can alter the physical and chemical characteristics of materials, potentially leading to advancements in areas such as polymer chemistry or the creation of new composites.
Check Digit Verification of cas no
The CAS Registry Mumber 188723-58-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,8,7,2 and 3 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 188723-58:
(8*1)+(7*8)+(6*8)+(5*7)+(4*2)+(3*3)+(2*5)+(1*8)=182
182 % 10 = 2
So 188723-58-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H6ClFO/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4H2
