18876-82-9 Usage
Uses
Used in Pharmaceutical Industry:
2-METHYL-1,3-THIAZOLE-4-CARBOXIMIDAMIDE HYDROCHLORIDE is used as a reagent for the preparation of triazoles, which are important in the development of pharmaceutical compounds due to their diverse range of biological activities and potential applications in drug discovery and medicinal chemistry.
Used in Chemical Synthesis:
2-METHYL-1,3-THIAZOLE-4-CARBOXIMIDAMIDE HYDROCHLORIDE is used as a key intermediate in the synthesis of various heterocyclic compounds, particularly triazoles, which are valuable for their unique chemical properties and potential applications in material science and organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 18876-82-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,8,7 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 18876-82:
(7*1)+(6*8)+(5*8)+(4*7)+(3*6)+(2*8)+(1*2)=159
159 % 10 = 9
So 18876-82-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3S.ClH/c1-3-8-4(2-9-3)5(6)7;/h2H,1H3,(H3,6,7);1H
