188944-77-6 Usage
Uses
Used in Organic Synthesis:
Bis(2,4,6-trimethylpyridine)bromonium hexafluorophosphate is used as a brominating agent for various organic synthesis applications. Its high selectivity and mild reaction conditions make it a valuable reagent for bromination reactions.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Bis(2,4,6-trimethylpyridine)bromonium hexafluorophosphate is used as a brominating agent for the synthesis of various pharmaceutical compounds. Its high selectivity and mild reaction conditions contribute to the efficient production of desired brominated products.
Used in Chemical Research:
Bis(2,4,6-trimethylpyridine)bromonium hexafluorophosphate is used as a brominating agent in chemical research for the synthesis and modification of various organic compounds. Its high selectivity and mild reaction conditions facilitate the exploration of new chemical reactions and the development of novel compounds.
Used in Material Science:
In material science, Bis(2,4,6-trimethylpyridine)bromonium hexafluorophosphate is used as a brominating agent for the synthesis of bromine-containing materials. Its high selectivity and mild reaction conditions enable the production of brominated materials with specific properties for various applications, such as polymers, dyes, and sensors.
Check Digit Verification of cas no
The CAS Registry Mumber 188944-77-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,8,9,4 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 188944-77:
(8*1)+(7*8)+(6*8)+(5*9)+(4*4)+(3*4)+(2*7)+(1*7)=206
206 % 10 = 6
So 188944-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H22BrN2.F6P/c1-11-7-13(3)18(14(4)8-11)17-19-15(5)9-12(2)10-16(19)6;1-7(2,3,4,5)6/h7-10H,1-6H3;/q+1;-1
