188944-77-6 Usage
General Description
Bis(2,4,6-trimethylpyridine)bromonium hexafluorophosphate is a chemical compound that consists of two molecules of 2,4,6-trimethylpyridine complexed with a bromonium cation and hexafluorophosphate anion. It is a complex salt that is commonly used as a brominating agent in organic synthesis. Bis(2,4,6-trimethylpyridine)bromonium hexafluorophosphate is known for its high selectivity and mild reaction conditions, making it a valuable reagent in various chemical reactions. Additionally, the presence of the 2,4,6-trimethylpyridine ligands provides steric hindrance, which can enhance the regioselectivity of the bromination reaction. Bis(2,4,6-trimethylpyridine)bromonium hexafluorophosphate is a versatile and efficient reagent in synthetic organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 188944-77-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,8,9,4 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 188944-77:
(8*1)+(7*8)+(6*8)+(5*9)+(4*4)+(3*4)+(2*7)+(1*7)=206
206 % 10 = 6
So 188944-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H22BrN2.F6P/c1-11-7-13(3)18(14(4)8-11)17-19-15(5)9-12(2)10-16(19)6;1-7(2,3,4,5)6/h7-10H,1-6H3;/q+1;-1
