188987-85-1 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Amino-6-fluoro-4-hydrazinopyrimidine serves as a key building block in the synthesis of a range of pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties, contributing to advancements in medicinal chemistry.
Used in Agrochemical Synthesis:
In the agrochemical industry, 2-Amino-6-fluoro-4-hydrazinopyrimidine is utilized for the creation of various agrochemicals. Its incorporation into these products can enhance their effectiveness in agricultural applications, such as pest control and crop protection.
Used as an Antimicrobial Agent:
2-Amino-6-fluoro-4-hydrazinopyrimidine is studied for its potential as an antimicrobial agent. Its ability to inhibit the growth of microorganisms makes it a candidate for use in treatments and products aimed at controlling bacterial infections.
Used as an Antiviral Agent:
2-AMINO-6-FLUORO-4-HYDRAZINOPYRIMIDINE is also being investigated for its antiviral properties. Its potential to combat viral infections positions it as a valuable asset in the development of antiviral medications and therapies.
Used in Organic Synthesis Research:
Due to its unique reactivity and structure, 2-Amino-6-fluoro-4-hydrazinopyrimidine is a subject of interest in organic synthesis research. It provides opportunities for the exploration of new synthetic pathways and the creation of novel chemical entities with potential applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 188987-85-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,8,9,8 and 7 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 188987-85:
(8*1)+(7*8)+(6*8)+(5*9)+(4*8)+(3*7)+(2*8)+(1*5)=231
231 % 10 = 1
So 188987-85-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H6FN5/c5-2-1-3(10-7)9-4(6)8-2/h1H,7H2,(H3,6,8,9,10)
